| CAS ID | 318-98-9 |
|---|---|
| IUPAC Name | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | |
| SMILES | CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O.Cl |
| CAS ID | 318-98-9 |
|---|---|
| IUPAC Name | 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | |
| SMILES | CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O.Cl |
| 62882 |
Synonym : propranolol hydrochloride, propranolol hcl, inderal, avlocardyl, herzbase, inderalici, naprilin, pronovan, dociton, ikopal
| Melting Point | 166°C |
| Color | White |
| Formula Weight | 295.81 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Propranolol Hydrochloride |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
