| CAS ID | 13565-97-4 |
|---|---|
| IUPAC Name | Zirconium pyrophosphate |
| Molecular Formula | O7P2Zr |
| Molecular Weight | |
| SMILES | O=P([O-])(OP([O-])([O-])=O)[O-].[Zr+4] |
| CAS ID | 13565-97-4 |
|---|---|
| IUPAC Name | Zirconium pyrophosphate |
| Molecular Formula | O7P2Zr |
| Molecular Weight | |
| SMILES | O=P([O-])(OP([O-])([O-])=O)[O-].[Zr+4] |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
