| CAS ID | 13463-41-7 |
|---|---|
| IUPAC Name | Zinc Pyrithione |
| Molecular Formula | C10H8N2O2S2Zn |
| Molecular Weight | |
| SMILES | C1=CC=[N+](C(=C1)[S-])[O-].C1=CC=[N+](C(=C1)[S-])[O-].[Zn+2] |
| CAS ID | 13463-41-7 |
|---|---|
| IUPAC Name | Zinc Pyrithione |
| Molecular Formula | C10H8N2O2S2Zn |
| Molecular Weight | |
| SMILES | C1=CC=[N+](C(=C1)[S-])[O-].C1=CC=[N+](C(=C1)[S-])[O-].[Zn+2] |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
