| CAS ID | 25899-70-1 |
|---|---|
| IUPAC Name | Xanthosine 5'-monophosphate disodium salt |
| Molecular Formula | C10H11N4Na2O9P |
| Molecular Weight | |
| SMILES | [Na+].[Na+].O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP([O-])([O-])=O)N1C=NC2=C1NC(=O)NC2=O |
| CAS ID | 25899-70-1 |
|---|---|
| IUPAC Name | Xanthosine 5'-monophosphate disodium salt |
| Molecular Formula | C10H11N4Na2O9P |
| Molecular Weight | |
| SMILES | [Na+].[Na+].O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP([O-])([O-])=O)N1C=NC2=C1NC(=O)NC2=O |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
