| CAS ID | 70321-86-7 |
|---|---|
| IUPAC Name | 2-(benzotriazol-2-yl)-4,6-bis(2-phenylpropan-2-yl)phenol |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | CC(C)(C1=CC=CC=C1)C2=CC(=C(C(=C2)N3N=C4C=CC=CC4=N3)O)C(C)(C)C5=CC=CC=C5 |
| CAS ID | 70321-86-7 |
|---|---|
| IUPAC Name | 2-(benzotriazol-2-yl)-4,6-bis(2-phenylpropan-2-yl)phenol |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | CC(C)(C1=CC=CC=C1)C2=CC(=C(C(=C2)N3N=C4C=CC=CC4=N3)O)C(C)(C)C5=CC=CC=C5 |
| 112412 |
| Color | White-Yellow |
| Melting Point | 140°C |
| Formula Weight | 447.58 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-(2H-Benzotriazol-2-yl)-4,6-bis(1-methyl-1-phenylethyl)phenol |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
