| CAS ID | 1109-15-5 |
|---|---|
| IUPAC Name | Tris pentafluorophenyl borane |
| Molecular Formula | C18BF15 |
| Molecular Weight | |
| SMILES | FC1=C(F)C(F)=C(B(C2=C(F)C(F)=C(F)C(F)=C2F)C2=C(F)C(F)=C(F)C(F)=C2F)C(F)=C1F |
| CAS ID | 1109-15-5 |
|---|---|
| IUPAC Name | Tris pentafluorophenyl borane |
| Molecular Formula | C18BF15 |
| Molecular Weight | |
| SMILES | FC1=C(F)C(F)=C(B(C2=C(F)C(F)=C(F)C(F)=C2F)C2=C(F)C(F)=C(F)C(F)=C2F)C(F)=C1F |
| 582056 |
Synonym: tris pentafluorophenyl borane, tris perfluorophenyl borane, tris pentafluorophenyl boron, tris 2,3,4,5,6-pentafluorophenyl borane, unii-i3wu5e2578, tris pentafluorophenyl-borane, borane, tris pentafluorophenyl, borane, tris 2,3,4,5,6-pentafluorophenyl, perfluorotriphenylboron, zlchem 1272
| Melting Point | 128°C |
| Color | Undesignated |
| Formula Weight | 511.98 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Tris(pentafluorophenyl)borane |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
