| CAS ID | 855-38-9 |
|---|---|
| IUPAC Name | tris(4-methoxyphenyl)phosphane |
| Molecular Formula | C21H21O3P |
| Molecular Weight | |
| SMILES | COC1=CC=C(C=C1)P(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC |
| CAS ID | 855-38-9 |
|---|---|
| IUPAC Name | tris(4-methoxyphenyl)phosphane |
| Molecular Formula | C21H21O3P |
| Molecular Weight | |
| SMILES | COC1=CC=C(C=C1)P(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC |
| 70071 |
Synonym : tris 4-methoxyphenyl phosphine, trianisylphosphine, tris p-anisyl phosphine, phosphine, tris 4-methoxyphenyl, tri-p-anisylphosphine, tris p-methoxyphenyl phosphine, tris 4-methoxyphenyl phosphane, phosphine, tris p-methoxyphenyl, tri 4-methoxyphenyl phosphine, tri p-methoxyphenyl phosphine
| Melting Point | 133°C |
| Color | White-Yellow |
| Formula Weight | 352.37 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Tris(4-methoxyphenyl)phosphine |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
