| CAS ID | 1095-03-0 |
|---|---|
| IUPAC Name | Triphenyl borate |
| Molecular Formula | C18H15BO3 |
| Molecular Weight | |
| SMILES | B(OC1=CC=CC=C1)(OC2=CC=CC=C2)OC3=CC=CC=C3 |
| CAS ID | 1095-03-0 |
|---|---|
| IUPAC Name | Triphenyl borate |
| Molecular Formula | C18H15BO3 |
| Molecular Weight | |
| SMILES | B(OC1=CC=CC=C1)(OC2=CC=CC=C2)OC3=CC=CC=C3 |
| 14182 |
Synonym: triphenoxyborane, phenyl borate, triphenoxyboron, boric acid, triphenyl ester, phenyl borate, pho 3 b, trifenylester kyseliny borite, boric acid h3bo3 , triphenyl ester, triphenyl ester boric acid, trifenylester kyseliny borite czech, boric acid triphenyl ester
| Color | White-Yellow |
| Melting Point | 101°C |
| Boiling Point | 158°C |
| UN Number | 2811 |
| Formula Weight | 290.13 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Triphenyl Borate |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
