| CAS ID | 1551-39-9 |
|---|---|
| IUPAC Name | tetrafluorobenzene-1,3-dicarboxylate |
| Molecular Formula | C8H2F4O4 |
| Molecular Weight | |
| SMILES | [O-]C(=O)C1=C(F)C(C([O-])=O)=C(F)C(F)=C1F |
| CAS ID | 1551-39-9 |
|---|---|
| IUPAC Name | tetrafluorobenzene-1,3-dicarboxylate |
| Molecular Formula | C8H2F4O4 |
| Molecular Weight | |
| SMILES | [O-]C(=O)C1=C(F)C(C([O-])=O)=C(F)C(F)=C1F |
| 297552 |
Synonym: tetrafluoroisophthalic acid, 2,4,5,6-tetrafluoroisophthalic acid, tetrafluoroisophthalicacid, tetrafluorobenzene-1,3-dicarboxylic acid, tetrafluoroisophthalic, rarechem al bo 0259, acmc-1c1aw
| Quantity | 5g |
| Melting Point | 211°C |
| Color | White |
| Formula Weight | 238.09 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Tetrafluoroisophthalic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
