| CAS ID | 206986-87-0 |
|---|---|
| IUPAC Name | sodium;(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate;hydrate |
| Molecular Formula | C24H39NaO5 |
| Molecular Weight | |
| SMILES | CC(CCC(=O)[O-])C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C.O.[Na+] |
| CAS ID | 206986-87-0 |
|---|---|
| IUPAC Name | sodium;(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate;hydrate |
| Molecular Formula | C24H39NaO5 |
| Molecular Weight | |
| SMILES | CC(CCC(=O)[O-])C1CCC2C1(C(CC3C2C(CC4C3(CCC(C4)O)C)O)O)C.O.[Na+] |
| 23679061 |
Synonym: sodium cholate hydrate, cholalic acid sodium salt, c24h39o5.na.h2o, sodium cholate hydrate, bioxtra, sodium cholate hydrate dried material, nt, sodium cholate hydrate, from ox and/or sheep bile, 3, a,7, a,12, a-trihydroxy-5, a-cholan-24-oic acid sodium salt, sodium cholate hydrate, suitable for cell culture, bioreagent, 4r-4-1s,2s,7s,11s,16s,5r,9r,10r,14r,15r-5,9,16-trihydroxy-2,15-dimethylte tracyclo 8.7.0.0<2,7>.0<11,15> heptadec-14-yl pentanoic acid, sodium salt, hyd rate, sodium cholate hydrate, pharmagrade, manufactured under appropriate controls for use as a raw material in pharma or biopharmaceutical production.
| Color | White |
| Beilstein | 3582354 |
| Merck Index | 14,2203 |
| Solubility Information | It is soluble in water. |
| Formula Weight | 430.6 |
| Chemical Name or Material | Cholic acid sodium salt |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
