| CAS ID | 129-00-0 |
|---|---|
| IUPAC Name | Pyrene |
| Molecular Formula | C16H10 |
| Molecular Weight | |
| SMILES | C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 |
| CAS ID | 129-00-0 |
|---|---|
| IUPAC Name | Pyrene |
| Molecular Formula | C16H10 |
| Molecular Weight | |
| SMILES | C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 |
| 31423 |
Synonym: benzo def phenanthrene, pyren, beta-pyrene, .beta.-pyrene, pyren german, unii-9e0t7wfw93, ccris 1256, pyrene def phenanthrene, coal tar pitch volatiles:pyrene
| Boiling Point | 393°C |
| Density | 1.271 |
| Flash Point | 208°C (406°F) |
| Melting Point | 148°C to 152°C |
| Beilstein | 1307225 |
| Merck Index | 14,7963 |
| Solubility Information | Soluble in toluene. Insoluble in water. |
| Formula Weight | 202.26 |
| Chemical Name or Material | Pyrene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
FAQs
