| CAS ID | 61-76-7 |
|---|---|
| IUPAC Name | hydrogen 3-[1-hydroxy-2-(methylamino)ethyl]phenol chloride |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | |
| SMILES | [H+].[Cl-].CNCC(O)C1=CC=CC(O)=C1 |
| CAS ID | 61-76-7 |
|---|---|
| IUPAC Name | hydrogen 3-[1-hydroxy-2-(methylamino)ethyl]phenol chloride |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | |
| SMILES | [H+].[Cl-].CNCC(O)C1=CC=CC(O)=C1 |
| 5284443 |
Synonym: phenylephrine hydrochloride, phenylephrine hcl, l-phenylephrine hydrochloride, metaoxedrine chloride, neosympatol, synethenate, almefrin, consdrin, emagrin, fenilfar
| Melting Point | 143°C |
| Color | White |
| Formula Weight | 203.67 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | (R)-Phenylephrine Hydrochloride |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
