| CAS ID | 18967-31-2 |
|---|---|
| IUPAC Name | Pentabromophenyl methacrylate |
| Molecular Formula | C10H5Br5O2 |
| Molecular Weight | |
| SMILES | CC(=C)C(=O)OC1=C(C(=C(C(=C1Br)Br)Br)Br)Br |
| CAS ID | 18967-31-2 |
|---|---|
| IUPAC Name | Pentabromophenyl methacrylate |
| Molecular Formula | C10H5Br5O2 |
| Molecular Weight | |
| SMILES | CC(=C)C(=O)OC1=C(C(=C(C(=C1Br)Br)Br)Br)Br |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
