| CAS ID | 467-62-9 |
|---|---|
| IUPAC Name | tris(4-aminophenyl)methanol |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)N)(C3=CC=C(C=C3)N)O)N |
| CAS ID | 467-62-9 |
|---|---|
| IUPAC Name | tris(4-aminophenyl)methanol |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)N)(C3=CC=C(C=C3)N)O)N |
| 10084 |
Synonym: pararosaniline base, tris 4-aminophenyl methanol, tris p-aminophenyl methanol, benzenemethanol, 4-amino-.alpha.,.alpha.-bis 4-aminophenyl, tris 4-aminophenyl methan-1-ol, fuchsin dye base, parafuchsin carbinol, tris 4-aminophenyl carbinol, methanol, tris 4-aminophenyl, 4,4′,4-triaminotrityl alcoholShow Less
| Color | Purple-Red |
| Melting Point | 205°C |
| Formula Weight | 305.38 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Pararosaniline |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
