| CAS ID | 84-15-1 |
|---|---|
| IUPAC Name | 1,2-diphenylbenzene |
| Molecular Formula | C18H14 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C3=CC=CC=C3 |
| CAS ID | 84-15-1 |
|---|---|
| IUPAC Name | 1,2-diphenylbenzene |
| Molecular Formula | C18H14 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C3=CC=CC=C3 |
| 6766 |
Synonym : o-terphenyl, 1,1′:2′,1-terphenyl, terphenyl, chlorinated, 1,1′-biphenyl, 2-phenyl, caswell no. 672b, o-diphenylbenzene, polychlorinated terphenyl, polychlorinated terphenyls, unii-w5675r7kvw, ccris 1655
| Color | White |
| Melting Point | 58°C |
| Boiling Point | 332°C |
| UN Number | 3077 |
| Formula Weight | 230.31 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | o-Terphenyl |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
