| CAS ID | 1313-97-9 |
|---|---|
| IUPAC Name | naphthalene-1-carbonyl chloride |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | ClC(=O)C1=C2C=CC=CC2=CC=C1 |
| CAS ID | 1313-97-9 |
|---|---|
| IUPAC Name | naphthalene-1-carbonyl chloride |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | ClC(=O)C1=C2C=CC=CC2=CC=C1 |
| 70146 |
Synonym:1-naphthoyl chloride, 1-naphthalenecarbonyl chloride, 1-naphthoylchloride, 1-naphthoic acid chloride, 1-chlorocarbonyl naphthalene, alpha-naphthoyl chloride, .alpha.-naphthoyl chloride, naphthalenecarbonyl chloride, naphthoylchloride, naphthoyl chloride
| Color | Yellow |
| UN Number | 3265 |
| Formula Weight | 190.63 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | 1-Naphthoyl Chloride |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
