| CAS ID | 66247-65-2 |
|---|---|
| IUPAC Name | 4-dibromophenyl)acetate, Methyl (2 |
| Molecular Formula | C9H8Br2O2 |
| Molecular Weight | |
| SMILES | O=C(OC)CC1=CC=C(Br)C=C1Br |
| CAS ID | 66247-65-2 |
|---|---|
| IUPAC Name | 4-dibromophenyl)acetate, Methyl (2 |
| Molecular Formula | C9H8Br2O2 |
| Molecular Weight | |
| SMILES | O=C(OC)CC1=CC=C(Br)C=C1Br |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
