| CAS ID | 4759-48-2 |
|---|---|
| IUPAC Name | (2Z,4E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid |
| Molecular Formula | C20H28O2 |
| Molecular Weight | |
| SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC(=O)O)C)C |
| CAS ID | 4759-48-2 |
|---|---|
| IUPAC Name | (2Z,4E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid |
| Molecular Formula | C20H28O2 |
| Molecular Weight | |
| SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC(=O)O)C)C |
| 131954766 |
Synonym: Isotretinoin
| Color | Yellow to Orange |
| Melting Point | 172°C to 175°C |
| Merck Index | 14,5228 |
| Quantity | 500mg |
| Solubility Information | Soluble in chloroform,dimethyl sulfoxide,water,ethanol,and ether. |
| Formula Weight | 300.44 |
| Physical Form | Powder |
| Chemical Name or Material | 13-cis-Retinoic acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
