| CAS ID | 206-44-0 |
|---|---|
| IUPAC Name | Fluoranthene |
| Molecular Formula | C16H10 |
| Molecular Weight | |
| SMILES | C1=CC=C2C(=C1)C1=CC=CC3=CC=CC2=C13 |
| CAS ID | 206-44-0 |
|---|---|
| IUPAC Name | Fluoranthene |
| Molecular Formula | C16H10 |
| Molecular Weight | |
| SMILES | C1=CC=C2C(=C1)C1=CC=CC3=CC=CC2=C13 |
| 9154 |
Synonym: idryl, 1,2-benzacenaphthene, benzo jk fluorene, rcra waste number u120, 1,2-1,8-naphthylene benzene, benzene, 1,2-1,8-naphthalenediyl, 1,2-1,8-naphthalenediyl benzene, benzene, 1,2-1,8-naphthylene, benzo j,k fluorene
| Color | Yellow |
| Boiling Point | 384°C |
| Melting Point | 110°C |
| Formula Weight | 202.26 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Fluoranthene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
