| CAS ID | 80-40-0 |
|---|---|
| IUPAC Name | Ethyl para toluenesulfonate |
| Molecular Formula | C9H12O3S |
| Molecular Weight | |
| SMILES | CCOS(=O)(=O)C1=CC=C(C=C1)C |
| CAS ID | 80-40-0 |
|---|---|
| IUPAC Name | Ethyl para toluenesulfonate |
| Molecular Formula | C9H12O3S |
| Molecular Weight | |
| SMILES | CCOS(=O)(=O)C1=CC=C(C=C1)C |
| 6638 |
Synonyms: ethyl p-toluenesulfonate, ethyl tosylate, ethyl p-tosylate, ethyl p-ts, benzenesulfonic acid, 4-methyl-, ethyl ester, ethyl p-methylbenzenesulfonate, ethyl-p-toluenesulfonate, p-toluenesulfonic acid, ethyl ester, ethyl pts, p-toluolsulfonsaeure aethyl ester
| Boiling Point | 173°C |
| Color | White-Yellow |
| Formula Weight | 200.25 |
| Physical Form | Crystal-Lump at 20°C |
| Chemical Name or Material | Ethyl p-Toluenesulfonate |
Ethyl para-toluenesulfonate is a versatile chemical compound with various applications in different industries.
Organic Synthesis: Ethyl para-toluenesulfonate is commonly used as a reagent in organic synthesis reactions. It can be used to introduce the para-toluenesulfonate functionality into various compounds, allowing for the synthesis of complex organic molecules.
Pharmaceutical Industry: This compound is also utilized in the pharmaceutical industry. It can be used as a starting material for synthesizing various active pharmaceutical ingredients, including sulfonamides, sulfones, and sulfonates.
High Purity: Ethyl para-toluenesulfonate is a high-purity compound, making it suitable for use in various applications requiring high-quality reagents.
Versatility: This compound offers versatility in organic synthesis, creating a wide range of organic compounds with unique properties and functionalities.
Handling and Storage: Proper handling and storage procedures should be followed like any chemical compound. It is crucial to store ethyl para-toluenesulfonate in a cool, dry place, away from sources of ignition and incompatible materials.
Personal Protective Equipment: When working with this compound, wear appropriate personal protective equipment, such as gloves, goggles, and a lab coat, to minimize the risk of exposure.
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
