| CAS ID | 94-05-3 |
|---|---|
| IUPAC Name | Ethyl (Ethoxymethylene) Cyanoacetate |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | |
| SMILES | CCOC(OC(CC#N)=O)(CC)OC(CC#N)=O |
| CAS ID | 94-05-3 |
|---|---|
| IUPAC Name | Ethyl (Ethoxymethylene) Cyanoacetate |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | |
| SMILES | CCOC(OC(CC#N)=O)(CC)OC(CC#N)=O |
| 1715183 |
Synonym: ethyl ethoxymethylene cyanoacetate, e-ethyl 2-cyano-3-ethoxyacrylate, ethyl 2-cyano-3-ethoxyacrylate, ethyl 3-ethoxy-2-cyanoacrylate, ethyl 2e-2-cyano-3-ethoxyprop-2-enoate, ethyl cyano ethoxymethylene acetate, 2-propenoic acid, 2-cyano-3-ethoxy-, ethyl ester, 2-cyano-3-ethoxy-2-propenoic acid ethyl ester, 2-cyano-3-ethoxyacrylic acid ethyl ester, ethyl 2e-2-cyano-3-ethoxy-2-propenoate
| Boiling Point | 191°C |
| Color | White-Yellow |
| Melting Point | 51°C |
| UN Number | 3439 |
| Formula Weight | 169.18 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Ethyl 2-(Ethoxymethylene)-2-cyanoacetate |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
