| CAS ID | 34363-28-5 |
|---|---|
| IUPAC Name | DL-alpha-glycerophosphate disodium salt |
| Molecular Formula | C3H7Na2O6P |
| Molecular Weight | |
| SMILES | O=P([O-])(OCC(CO)O)[O-].[Na+].[Na+] |
| CAS ID | 34363-28-5 |
|---|---|
| IUPAC Name | DL-alpha-glycerophosphate disodium salt |
| Molecular Formula | C3H7Na2O6P |
| Molecular Weight | |
| SMILES | O=P([O-])(OCC(CO)O)[O-].[Na+].[Na+] |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
