| CAS ID | 26386-88-9 |
|---|---|
| Molecular Formula | C12H10N3OP |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)OP(=O)(N=[N+]=[N-])OC2=CC=CC=C2r |
| CAS ID | 26386-88-9 |
|---|---|
| Molecular Formula | C12H10N3OP |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)OP(=O)(N=[N+]=[N-])OC2=CC=CC=C2r |
| 123414 |
Synonym: diphenylphosphoryl azide, diphenyl azidophosphate, diphenylphosphonic azide, diphenyl phosphoryl azide, diphenyl phosphorazidate, phosphorazidic acid, diphenyl ester, azido phenoxy phosphoryl oxy benzene, dppa polymer-bound, diphenylphosphorazidate, unii-gxm91165av
| Color | Yellow |
| UN Number | 3278 |
| Formula Weight | 275.20 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | Diphenylphosphoryl Azide |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
