| CAS ID | 122-39-4 |
|---|---|
| IUPAC Name | N-phenylaniline |
| Molecular Formula | C12H11N |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2 |
| CAS ID | 122-39-4 |
|---|---|
| IUPAC Name | N-phenylaniline |
| Molecular Formula | C12H11N |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2 |
| 11487 |
Synonym: diphenylamine, n-phenylbenzenamine, anilinobenzene, benzenamine, n-phenyl, n,n-diphenylamine, phenylaniline, scaldip, n-phenylbenzeneamine, big dipper, no-scald
| Color | White |
| Boiling Point | 302°C |
| Identification | Passes Test |
| Sensitivity | Passes Test |
| Density | 1.16g/cm3 |
| Flash Point | 153°C |
| Packaging | Amber Glass |
| CAS Max % | 100 |
| Linear Formula | C12H11N |
| Solubility Information | Soluble in water |
| Formula Weight | 169.22 |
| Physical Form | Solid |
| Grade | ACS |
| Chemical Name or Material | Diphenylamine |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
