| CAS ID | 101-84-8 |
|---|---|
| IUPAC Name | phenoxybenzene |
| Molecular Formula | C12H10O |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2 |
| CAS ID | 101-84-8 |
|---|---|
| IUPAC Name | phenoxybenzene |
| Molecular Formula | C12H10O |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2 |
| 7583 |
Synonym: diphenyl ether, diphenyl oxide, phenyl ether, oxydibenzene, phenyl oxide, oxybisbenzene, biphenyl oxide, 1,1′-oxydibenzene, benzene, 1,1′-oxybis, oxydiphenyl
| Color | White |
| Boiling Point | 258°C |
| UN Number | 3077 |
| Formula Weight | 170.21 |
| Physical Form | Crystal-Lump at 20°C |
| Chemical Name or Material | Phenyl Ether |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
