| CAS ID | 1666-13-3 |
|---|---|
| IUPAC Name | (phenyldiselanyl)benzene |
| Molecular Formula | C12H10Se2 |
| Molecular Weight | |
| SMILES | [Se]([Se]C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS ID | 1666-13-3 |
|---|---|
| IUPAC Name | (phenyldiselanyl)benzene |
| Molecular Formula | C12H10Se2 |
| Molecular Weight | |
| SMILES | [Se]([Se]C1=CC=CC=C1)C1=CC=CC=C1 |
| 15460 |
Synonym: diphenyl diselenide, diselenide, diphenyl, phenyl diselenide, 1,2-diphenyldiselane, diphenyldiselenide, bis phenylselenide, phenyldiselanyl benzene, diphenyldiselane, ccris 9227, acmc-209duq
| Melting Point | 61°C |
| Color | Yellow |
| Boiling Point | 202°C |
| UN Number | 3283 |
| Formula Weight | 312.13 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Diphenyl Diselenide |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
