| CAS ID | 1459-93-4 |
|---|---|
| IUPAC Name | 1,3-dimethyl benzene-1,3-dicarboxylate |
| Molecular Formula | C10H8O4(-2) |
| Molecular Weight | |
| SMILES | COC(=O)C1=CC(=CC=C1)C(=O)OC |
| CAS ID | 1459-93-4 |
|---|---|
| IUPAC Name | 1,3-dimethyl benzene-1,3-dicarboxylate |
| Molecular Formula | C10H8O4(-2) |
| Molecular Weight | |
| SMILES | COC(=O)C1=CC(=CC=C1)C(=O)OC |
| 15088 |
Synonym: dimethyl isophthalate, dimethyl m-phthalate, isophthalic acid dimethyl ester, methyl isophthalate, 1,3-benzenedicarboxylic acid, dimethyl ester, morflex 1129, dimethyl 1,3-benzenedicarboxylate, dimethylisophthalate, methyl 3-carbomethoxy benzoate, isophthalic acid, dimethyl ester
| Melting Point | 69°C |
| Color | White |
| Boiling Point | 124°C |
| Formula Weight | 194.19 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Dimethyl Isophthalate |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
