| CAS ID | 40876-98-0 |
|---|---|
| IUPAC Name | sodium;1,4-diethoxy-1,4-dioxobut-2-en-2-olate |
| Molecular Formula | C8H10Na2O5 |
| Molecular Weight | |
| SMILES | CCOC(=O)C=C(C(=O)OCC)[O-].[Na+] |
| CAS ID | 40876-98-0 |
|---|---|
| IUPAC Name | sodium;1,4-diethoxy-1,4-dioxobut-2-en-2-olate |
| Molecular Formula | C8H10Na2O5 |
| Molecular Weight | |
| SMILES | CCOC(=O)C=C(C(=O)OCC)[O-].[Na+] |
| 44134875 |
Synonym:diethyl oxalacetate sodium salt, sodium z-1,4-diethoxy-1,4-dioxo-but-2-en-2-olate, ethyl sodium oxaloacetate, sodium-1,4-diethoxy-1,4-dioxobut-2-en-2-olate, ksc915o5n
| Color | Undesignated |
| Formula Weight | 210.16 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Diethyl Oxalacetate Sodium Salt |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
