| CAS ID | 1068-90-2 |
|---|---|
| IUPAC Name | Diethyl Aceamidomalonate |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | |
| SMILES | O=C(OCC)C(NC(C=C)=O)C(OCC)=O |
| CAS ID | 1068-90-2 |
|---|---|
| IUPAC Name | Diethyl Aceamidomalonate |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | |
| SMILES | O=C(OCC)C(NC(C=C)=O)C(OCC)=O |
| 14041 |
Synonym: diethyl acetamidomalonate, diethyl 2-acetamidomalonate, diethyl acetaminomalonate, diethyl acetylaminomalonate, acetamidomalonic acid diethyl ester, 2-acetylaminomalonic acid diethyl ester, 1,3-diethyl 2-acetamidopropanedioate, diethyl acetylamino malonate, propanedioic acid, acetylamino-, diethyl ester, acetylamino propanedioic acid diethyl ester
| Color | White |
| Melting Point | 96°C |
| Formula Weight | 217.22 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Diethyl Acetamidomalonate |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
