| CAS ID | 69-65-8 |
|---|---|
| IUPAC Name | D-Mannitol |
| Molecular Formula | C6H14O6 |
| Molecular Weight | |
| SMILES | OC[C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| CAS ID | 69-65-8 |
|---|---|
| IUPAC Name | D-Mannitol |
| Molecular Formula | C6H14O6 |
| Molecular Weight | |
| SMILES | OC[C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| 6251 |
Synonym: d-mannitol, mannitol, mannite, osmitrol, manna sugar, osmofundin, cordycepic acid, mannit, mannazucker, mannidex
| Alpha Vector | Mannitol |
| Color | White |
| Melting Point | 165°C |
| Boiling Point | 295°C |
| Ignition Residue | 0.01% max. |
| Loss on Drying | 0.05% max. |
| Identification | Pass Test |
| Packaging | Fiber Drum |
| Solubility Information | 0.01% max. Insoluble Matter |
| Specific Rotation | 23.3 to 24.3° (+ or -) |
| Formula Weight | 182.17 |
| Physical Form | Solid |
| Grade | Certified ACS |
| Chemical Name or Material | D-Mannitol |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
