| CAS ID | 58-85-5 |
|---|---|
| IUPAC Name | 5-{2-oxo-hexahydro-1H-thieno[3,4-d]imidazol-4-yl}pentanoic acid |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | |
| SMILES | OC(=O)CCCCC1SCC2NC(=O)NC12 |
| CAS ID | 58-85-5 |
|---|---|
| IUPAC Name | 5-{2-oxo-hexahydro-1H-thieno[3,4-d]imidazol-4-yl}pentanoic acid |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | |
| SMILES | OC(=O)CCCCC1SCC2NC(=O)NC12 |
| 171548 |
Synonym: biotin, d-biotin, vitamin h, coenzyme r, vitamin b7, bios ii, factor s, bioepiderm, d +-biotin, biodermatin
| Color | White |
| Melting Point | 230°C |
| Formula Weight | 244.31 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Biotin |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
