| CAS ID | 134-83-8 |
|---|---|
| IUPAC Name | 1-chloro-4-[chloro(phenyl)methyl]benzene |
| Molecular Formula | C13H10Cl2 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)Cl |
| CAS ID | 134-83-8 |
|---|---|
| IUPAC Name | 1-chloro-4-[chloro(phenyl)methyl]benzene |
| Molecular Formula | C13H10Cl2 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)Cl |
| 241584 |
Synonym: 4-chlorobenzhydryl chloride, 4-chlorobenzhydrylchloride, p-chlorobenzhydryl chloride, 1-chloro-4-chloro phenyl methyl benzene, benzene, 1-chloro-4-chlorophenylmethyl, chloro 4-chlorophenyl phenylmethane, chloro p-chlorophenyl phenylmethane, methane, chloro p-chlorophenyl phenyl, 1-chloro-4-chlorophenylmethyl benzene
| Boiling Point | 160°C |
| Color | Yellow |
| UN Number | 1760 |
| Formula Weight | 237.12 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | 4-Chlorobenzhydryl Chloride |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
