| CAS ID | 58-08-2 |
|---|---|
| IUPAC Name | 1,3,7-trimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | |
| SMILES | CN1C=NC2=C1C(=O)N(C)C(=O)N2C |
| CAS ID | 58-08-2 |
|---|---|
| IUPAC Name | 1,3,7-trimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | |
| SMILES | CN1C=NC2=C1C(=O)N(C)C(=O)N2C |
| 2519 |
Synonym: caffeine, 1,3,7-trimethylxanthine, guaranine, thein, cafeina, methyltheobromine, koffein, mateina, theine, alert-pep
| pH | 6.9 (1% H2O soln.) |
| Color | White |
| Melting Point | 238°C |
| UN Number | 1544 |
| Formula Weight | 194.19 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Caffeine |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
