| CAS ID | 13734-34-4 |
|---|---|
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C(=O)O |
| CAS ID | 13734-34-4 |
|---|---|
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C(=O)O |
| 77857 |
Alternate Names:N-(tert-Butoxycarbonyl)-L-phenylalanine; Boc-L-phenylalanine
| Assay Percent Range | 99+% |
| Linear Formula | C6H5CH2CH(COOH)NHCOOC(CH3)3 |
| Infrared Spectrum | Authentic |
| Beilstein | 14, 1595 |
| Packaging | Glass bottle |
| Formula Weight | 265.3 |
| Specific Rotation | + 25.00 |
| Physical Form | Fine Crystalline Powder |
| Solubility | Solubility in water: insoluble. Other solubilities: soluble in ethanol and methylene chloride, insoluble in aliphatic hydrocarbon |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
