| CAS ID | 2592-18-9 |
|---|---|
| IUPAC Name | (2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| Molecular Formula | C18H34N2O10 |
| Molecular Weight | |
| SMILES | CC(C(C(=O)O)NC(=O)OC(C)(C)C)O |
| CAS ID | 2592-18-9 |
|---|---|
| IUPAC Name | (2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| Molecular Formula | C18H34N2O10 |
| Molecular Weight | |
| SMILES | CC(C(C(=O)O)NC(=O)OC(C)(C)C)O |
| 2724766 |
Synonym: boc-thr-oh, boc-l-threonine, n-boc-l-threonine, boc-threonine, n-tert-butoxycarbonyl-l-threonine, 2s,3r-2-tert-butoxycarbonyl amino-3-hydroxybutanoic acid, threonine, n-1,1-dimethylethoxy carbonyl, 2s,3r-2-tert-butoxycarbonylamino-3-hydroxybutanoic acid, 2s,3r-2-tert-butoxy carbonyl amino-3-hydroxybutanoic acid
| Melting Point | 84°C |
| Color | White |
| Formula Weight | 219.24 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | N-(tert-Butoxycarbonyl)-L-threonine |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
