| CAS ID | 47173-80-8 |
|---|---|
| IUPAC Name | (2R)-3-(benzyloxy)-2-{[(tert-butoxy)carbonyl]amino}propanoate |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | |
| SMILES | CC(C)(C)OC(=O)N[C@H](COCC1=CC=CC=C1)C([O-])=O |
| CAS ID | 47173-80-8 |
|---|---|
| IUPAC Name | (2R)-3-(benzyloxy)-2-{[(tert-butoxy)carbonyl]amino}propanoate |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | |
| SMILES | CC(C)(C)OC(=O)N[C@H](COCC1=CC=CC=C1)C([O-])=O |
| 2733693 |
Synonym: n-boc-o-benzyl-d-serine, boc-d-ser bzl-oh, boc-o-benzyl-d-serine, o-benzyl-n-tert-butoxycarbonyl-d-serine, d-serine, n-1,1-dimethylethoxy carbonyl-o-phenylmethyl, 2r-3-benzyloxy-2-tert-butoxycarbonyl amino propanoic acid, 2r-3-benzyl-oxy-2-tert-butoxy carbonyl amino propanoic acid, pubchem12444, pubchem14944, boc-d-ser obn-oh
| Melting Point | 60°C |
| Color | White |
| Formula Weight | 295.34 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | O-Benzyl-N-(tert-butoxycarbonyl)-D-serine |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
