| CAS ID | 13836-37-8 |
|---|---|
| IUPAC Name | (2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| Molecular Formula | C18H28N4O6S |
| Molecular Weight | |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=NCCCC(C(=O)O)NC(=O)OC(C)(C)C)N |
| CAS ID | 13836-37-8 |
|---|---|
| IUPAC Name | (2S)-5-[[amino-[(4-methylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| Molecular Formula | C18H28N4O6S |
| Molecular Weight | |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=NCCCC(C(=O)O)NC(=O)OC(C)(C)C)N |
| 83767 |
| Formula Weight | 428.50 |
| Physical Form | Crystal-Powder at 20°C |
| Percent Purity | ≥95.0% (HPLC,T) |
| Color | White |
| Melting Point | 105°C |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
