| CAS ID | 30992-29-1 |
|---|---|
| IUPAC Name | 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)O |
| CAS ID | 30992-29-1 |
|---|---|
| IUPAC Name | 2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)C(=O)O |
| 2733845 |
Synonym: boc-aib-oh, boc-alpha-methylalanine, 2-boc-amino isobutyric acid, 2-tert-butoxycarbonyl amino-2-methylpropanoic acid, boc-2-aminoisobutyric acid, n-boc-2-aminoisobutyric acid, n-boc-alpha-methylalanine, n-boc-2-amino-2-methylpropanoic acid, 2-tert-butoxy carbonyl amino-2-methylpropanoic acid, 2-tert-butoxycarbonylamino isobutyric acid
| Color | White-Yellow |
| Melting Point | 120°C |
| Formula Weight | 203.24 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-(tert-Butoxycarbonylamino)isobutyric Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
