| CAS ID | 73183-34-3 |
|---|---|
| IUPAC Name | Bis(pinacolato)diboron |
| Molecular Formula | C12H24B2O4 |
| Molecular Weight | |
| SMILES | CC1(C)C(C)(C)OB(B2OC(C)(C)C(C)(C)O2)O1 |
| CAS ID | 73183-34-3 |
|---|---|
| IUPAC Name | Bis(pinacolato)diboron |
| Molecular Formula | C12H24B2O4 |
| Molecular Weight | |
| SMILES | CC1(C)C(C)(C)OB(B2OC(C)(C)C(C)(C)O2)O1 |
| 2733548 |
Synonym: bis pinacolato diboron, bis pinacolato diborane, 4,4,4′,4′,5,5,5′,5′-octamethyl-2,2′-bi 1,3,2-dioxaborolane, pinacol diborane, diboron pinacol ester, b2pin2, 4,4,4′,4′,5,5,5′,5′-octamethyl-2,2′-bi-1,3,2-dioxaborolane, 4,4,5,5-tetramethyl-2-tetramethyl-1,3,2-dioxaborolan-2-yl-1,3,2-dioxaborolane, bispinacolate diboron, unii-i906w26p4u
| Melting Point | 138°C |
| Color | White-Yellow |
| Quantity | 5g |
| Formula Weight | 253.94 |
| Physical Form | Crystal-Powder at 20°C |
| Percent Purity | ≥99.0% (GC) |
| Chemical Name or Material | Bis(pinacolato)diboron |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
