| CAS ID | 603-50-9 |
|---|---|
| IUPAC Name | 4-{[4-(acetyloxy)phenyl](pyridin-2-yl)methyl}phenyl acetate |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | |
| SMILES | CC(=O)OC1=CC=C(C=C1)C(C1=CC=C(OC(C)=O)C=C1)C1=CC=CC=N1 |
| CAS ID | 603-50-9 |
|---|---|
| IUPAC Name | 4-{[4-(acetyloxy)phenyl](pyridin-2-yl)methyl}phenyl acetate |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | |
| SMILES | CC(=O)OC1=CC=C(C=C1)C(C1=CC=C(OC(C)=O)C=C1)C1=CC=CC=N1 |
| 2391 |
Synonym: bisacodyl, dulcolax, bicol, brocalax, durolax, dulcolan, endokolat, fenilaxan, hillcolax, sanvacual
| Melting Point | 134°C |
| Color | White |
| Formula Weight | 361.40 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Bisacodyl |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
