| CAS ID | 3130-19-6 |
|---|---|
| IUPAC Name | bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) hexanedioate |
| Molecular Formula | C20H28O6(-2) |
| Molecular Weight | |
| SMILES | O=C([O-])C(CC1CC(O2)C2CC1)(CC3CC(O4)C4CC3)CCCC([O-])=O |
| CAS ID | 3130-19-6 |
|---|---|
| IUPAC Name | bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) hexanedioate |
| Molecular Formula | C20H28O6(-2) |
| Molecular Weight | |
| SMILES | O=C([O-])C(CC1CC(O2)C2CC1)(CC3CC(O4)C4CC3)CCCC([O-])=O |
PubChem CID 18410
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
