| CAS ID | 14254-41-2 |
|---|---|
| IUPAC Name | 4-dichlorophenyl) chlorophosphate, Bis(2 |
| Molecular Formula | C12H6Cl5O3P |
| Molecular Weight | |
| SMILES | O=P(OC1=CC=C(Cl)C=C1Cl)(Cl)OC2=CC=C(Cl)C=C2Cl |
| CAS ID | 14254-41-2 |
|---|---|
| IUPAC Name | 4-dichlorophenyl) chlorophosphate, Bis(2 |
| Molecular Formula | C12H6Cl5O3P |
| Molecular Weight | |
| SMILES | O=P(OC1=CC=C(Cl)C=C1Cl)(Cl)OC2=CC=C(Cl)C=C2Cl |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
