| CAS ID | 10470-57-2 |
|---|---|
| IUPAC Name | Beta, y-Methyleneguanosine 5'-triphosphate sodium salt |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(CP(=O)(O)O)O)O)O)NC(=NC2=O)N.[Na] |
| CAS ID | 10470-57-2 |
|---|---|
| IUPAC Name | Beta, y-Methyleneguanosine 5'-triphosphate sodium salt |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(CP(=O)(O)O)O)O)O)NC(=NC2=O)N.[Na] |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
