| CAS ID | 120-51-4 |
|---|---|
| IUPAC Name | Benzyl Benzoate |
| Molecular Formula | C14H12O2 |
| Molecular Weight | |
| SMILES | O=C(OCC1=CC=CC=C1)C1=CC=CC=C1 |
| CAS ID | 120-51-4 |
|---|---|
| IUPAC Name | Benzyl Benzoate |
| Molecular Formula | C14H12O2 |
| Molecular Weight | |
| SMILES | O=C(OCC1=CC=CC=C1)C1=CC=CC=C1 |
| 2345 |
Synonym: ascabiol, benylate, novoscabin, benzoic acid, phenylmethyl ester, scabitox, scobenol, ascabin, benzyl phenylformate, benzoic acid, benzyl ester, phenylmethyl benzoate
| Refractive Index | 1.5670 to 1.5700 |
| Specific Gravity | 1.118 |
| Packaging | Glass bottle |
| Infrared Spectrum | Authentic |
| Flash Point | 147°C |
| Boiling Point | 323.0°C |
| Viscosity | 10.9 mPa.s (25°C) |
| Melting Point | 18.0°C to 20.0°C |
| Acidity | 0.3mg KOH/g max. |
| Color | Colorless |
| Density | 1.1180g/mL |
| CAS Min % | 99.0 |
| CAS Max % | 100.0 |
| Assay Percent Range | 99% min. (GC) |
| Linear Formula | C6H5CO2CH2C6H5 |
| Beilstein | 09, 121 |
| Merck Index | 15, 1130 |
| Solubility Information | Solubility in water: 15.3mg/l (20°C). Other solubilities: soluble in alcohol,chloroform and ether,insoluble in glycerol |
| Formula Weight | 212.25 |
| Physical Form | Liquid |
| Chemical Name or Material | Benzyl benzoate |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
