| CAS ID | 119-61-9 |
|---|---|
| IUPAC Name | diphenylmethanone |
| Molecular Formula | C13H10O |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| CAS ID | 119-61-9 |
|---|---|
| IUPAC Name | diphenylmethanone |
| Molecular Formula | C13H10O |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| 3102 |
Synonym: benzophenone, diphenyl ketone, benzoylbenzene, phenyl ketone, methanone, diphenyl, alpha-oxoditane, ketone, diphenyl, benzene, benzoyl, alpha-oxodiphenylmethane, diphenylketone
| Melting Point | 49°C |
| Boiling Point | 305°C |
| Color | White-Yellow |
| UN Number | 3077 |
| Formula Weight | 182.22 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Benzophenone |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
