| CAS ID | 5350-57-2 |
|---|---|
| IUPAC Name | Benzophenone hydrazone |
| Molecular Formula | C13H12N2 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C(=NN)C2=CC=CC=C2 |
| CAS ID | 5350-57-2 |
|---|---|
| IUPAC Name | Benzophenone hydrazone |
| Molecular Formula | C13H12N2 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C(=NN)C2=CC=CC=C2 |
| 79304 |
Synonym : benzophenone hydrazone, diphenylmethylene hydrazine, benzophenonehydrazone, methanone, diphenyl-, hydrazone, diphenylmethanone hydrazone, benzophenone, hydrazone, diphenylmethylidene hydrazine, diphenyl ketone hydrazone, benzophenone hydrozone, nsc 43
| Color | White-Yellow |
| Melting Point | 99°C |
| Boiling Point | 230°C |
| Formula Weight | 196.25 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Benzophenone Hydrazone |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
