| CAS ID | 633-96-5 |
|---|---|
| IUPAC Name | Acid Orange 7 |
| Molecular Formula | C16H11N2NaO4S |
| Molecular Weight | |
| SMILES | O=C1C=CC2=CC=CC=C2/C1=NNC3=CC=C(S(=O)([O-])=O)C=C3.[Na+] |
| CAS ID | 633-96-5 |
|---|---|
| IUPAC Name | Acid Orange 7 |
| Molecular Formula | C16H11N2NaO4S |
| Molecular Weight | |
| SMILES | O=C1C=CC2=CC=CC=C2/C1=NNC3=CC=C(S(=O)([O-])=O)C=C3.[Na+] |
| 44135675 |
Synonym: c.i. acid orange 7, orange ii, acid orange 7, orange, c.i. acid orange 7, monosodium salt, dsstox_cid_18881, dsstox_rid_79415, dsstox_gsid_38881, sodium 4-e-2-2-hydroxynaphthalen-1-yl diazen-1-yl benzenesulfonate, benzenesulfonic acid, 4-2-2-hydroxy-1-naphthalenyl diazenyl-, sodium salt 1:1
| Melting Point | 164°C |
| Color | Undesignated |
| Formula Weight | 350.32 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Acid Orange 7 |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
