| CAS ID | 6326-79-0 |
|---|---|
| IUPAC Name | 6-bromo-2,3-dihydro-1H-indole-2,3-dione |
| Molecular Formula | C8H4BrNO2 |
| Molecular Weight | |
| SMILES | BrC1=CC=C2C(NC(=O)C2=O)=C1 |
| CAS ID | 6326-79-0 |
|---|---|
| IUPAC Name | 6-bromo-2,3-dihydro-1H-indole-2,3-dione |
| Molecular Formula | C8H4BrNO2 |
| Molecular Weight | |
| SMILES | BrC1=CC=C2C(NC(=O)C2=O)=C1 |
| 95716 |
Synonyms: 6-bromoisatin, 6-bromoindoline-2,3-dione, 6-bromo-isatin, 1h-indole-2,3-dione, 6-bromo, 6-bromoindole-2,3-dione, 6-bromo-2,3-dihydro-1h-indole-2,3-dione, 6-bromo-1h-benzo d azolidine-2,3-dione, 6-bromoindolin-2,3-dione, 6-bromo-2,3-indolinedione
| Melting Point | 274°C |
| Color | Undesignated |
| Formula Weight | 226.03 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 6-Bromoisatin |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
The bromoisatin chemical formula is C8H4BrNO2. It is a halogenated derivative of isatin, featuring a bromine atom substituted on the aromatic ring.
The bromoisatin molecular weight is 226.03 g/mol. This molecular mass is used in calculating concentrations for research and development applications.
The melting point of bromoisatin is approximately 285–287°C (545–548.6°F). This high melting point indicates a stable, crystalline solid commonly used in organic synthesis.
6-Bromoisatin is primarily used in pharmaceutical and biochemical research. It serves as a building block in the synthesis of heterocyclic compounds, and is also studied for its potential anti-cancer, anti-inflammatory, and antimicrobial properties.
6-Bromoisatin has limited solubility in water but is more soluble in organic solvents such as DMSO, ethanol, or acetone. This property makes it suitable for use in non-aqueous reaction systems
