| CAS ID | 54-20-6 |
|---|---|
| IUPAC Name | 5-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| Molecular Formula | C5H3F3N2O2 |
| Molecular Weight | |
| SMILES | C1=C(C(=O)NC(=O)N1)C(F)(F)F |
| CAS ID | 54-20-6 |
|---|---|
| IUPAC Name | 5-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| Molecular Formula | C5H3F3N2O2 |
| Molecular Weight | |
| SMILES | C1=C(C(=O)NC(=O)N1)C(F)(F)F |
| 5899 |
Synonym: 5-trifluoromethyl uracil, 5-trifluoromethyluracil, 5-trifluoromethyl pyrimidine-2,4 1h,3h-dione, trifluoromethyluracil, 2,4 1h,3h-pyrimidinedione, 5-trifluoromethyl, 5-tfmu, uracil, 5-trifluoromethyl, 5-trifluoromethyl pyrimidine-2,4-diol, 5-trifluoromethyl-uracil
| Color | White-Yellow |
| Formula Weight | 180.09 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 5-(Trifluoromethyl)uracil |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
