| CAS ID | 443-69-6 |
|---|---|
| IUPAC Name | 5-fluoro-1H-indole-2,3-dione |
| Molecular Formula | C8H4FNO2 |
| Molecular Weight | |
| SMILES | C1=CC2=C(C=C1F)C(=O)C(=O)N2 |
| CAS ID | 443-69-6 |
|---|---|
| IUPAC Name | 5-fluoro-1H-indole-2,3-dione |
| Molecular Formula | C8H4FNO2 |
| Molecular Weight | |
| SMILES | C1=CC2=C(C=C1F)C(=O)C(=O)N2 |
| 236566 |
Synonym: 5-fluoroisatin, 5-fluoroindoline-2,3-dione, 5-fluoro isatin, 5-fluoro-2,3-dihydro-1h-indole-2,3-dione, 5-fluoroisatine, 5-fluoro-2,3-indoledione, 5-fluoroindole-2,3-dione, 1h-indole-2,3-dione, 5-fluoro, 5-fluoro-2,3-indolinedione, 5-fluoro-2,3-indolindione
| Color | Undesignated |
| Melting Point | 227°C |
| Formula Weight | 165.12 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 5-Fluoroisatin |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
